C15H11F2N — CID 59928913
1,9-difluoro-3,8-dimethylbenzo[h]isoquinoline (PubChem CID 59928913) has the molecular formula C15H11F2N and a molecular weight of 243.26 g/mol. Its IUPAC name is 1,9-difluoro-3,8-dimethylbenzo[h]isoquinoline.
| Compound Name | 1,9-difluoro-3,8-dimethylbenzo[h]isoquinoline |
|---|---|
| PubChem CID | 59928913 |
| Molecular Formula | C15H11F2N |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1,9-difluoro-3,8-dimethylbenzo[h]isoquinoline |
| SMILES | Cc1cc2ccc3cc(C)c(F)cc3c2c(F)n1 |
| InChI | InChI=1S/C15H11F2N/c1-8-5-10-3-4-11-6-9(2)18-15(17)14(11)12(10)7-13(8)16/h3-7H,1-2H3 |
| InChIKey | XIJNRUUJIJPNKN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|