C24H29ClN2O5 — CID 14553659
5,6-dimethoxy-2-[[1-[(4-nitrophenyl)methyl]piperidin-4-yl]methyl]-2,3-dihydroinden-1-one;hydrochloride (PubChem CID 14553659) has the molecular formula C24H29ClN2O5 and a molecular weight of 460.96 g/mol. Its IUPAC name is 5,6-dimethoxy-2-[[1-[(4-nitrophenyl)methyl]piperidin-4-yl]methyl]-2,3-dihydroinden-1-one;hydrochloride.
| Compound Name | 5,6-dimethoxy-2-[[1-[(4-nitrophenyl)methyl]piperidin-4-yl]methyl]-2,3-dihydroinden-1-one;hydrochloride |
|---|---|
| PubChem CID | 14553659 |
| Molecular Formula | C24H29ClN2O5 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 5,6-dimethoxy-2-[[1-[(4-nitrophenyl)methyl]piperidin-4-yl]methyl]-2,3-dihydroinden-1-one;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CC1CCN(Cc3ccc([N+](=O)[O-])cc3)CC1)C2.Cl |
| InChI | InChI=1S/C24H28N2O5.ClH/c1-30-22-13-18-12-19(24(27)21(18)14-23(22)31-2)11-16-7-9-25(10-8-16)15-17-3-5-20(6-4-17)26(28)29;/h3-6,13-14,16,19H,7-12,15H2,1-2H3;1H |
| InChIKey | OXSISDRQMPKLRR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|