C20H26N3O5P — CID 14555662
2-[benzyl(ethyl)amino]-1-(4-imidazol-1-ylphenyl)ethanol;phosphoric acid (PubChem CID 14555662) has the molecular formula C20H26N3O5P and a molecular weight of 419.42 g/mol. Its IUPAC name is 2-[benzyl(ethyl)amino]-1-(4-imidazol-1-ylphenyl)ethanol;phosphoric acid.
| Compound Name | 2-[benzyl(ethyl)amino]-1-(4-imidazol-1-ylphenyl)ethanol;phosphoric acid |
|---|---|
| PubChem CID | 14555662 |
| Molecular Formula | C20H26N3O5P |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 2-[benzyl(ethyl)amino]-1-(4-imidazol-1-ylphenyl)ethanol;phosphoric acid |
| SMILES | CCN(Cc1ccccc1)CC(O)c1ccc(-n2ccnc2)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C20H23N3O.H3O4P/c1-2-22(14-17-6-4-3-5-7-17)15-20(24)18-8-10-19(11-9-18)23-13-12-21-16-23;1-5(2,3)4/h3-13,16,20,24H,2,14-15H2,1H3;(H3,1,2,3,4) |
| InChIKey | IHDGGNMQPYPXES-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|