C21H38N8O3S — CID 14558343
2-[[1-amino-8-(3-aminopropylamino)octan-3-yl]sulfanylmethyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol (PubChem CID 14558343) has the molecular formula C21H38N8O3S and a molecular weight of 482.66 g/mol. Its IUPAC name is 2-[[1-amino-8-(3-aminopropylamino)octan-3-yl]sulfanylmethyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol.
| Compound Name | 2-[[1-amino-8-(3-aminopropylamino)octan-3-yl]sulfanylmethyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 14558343 |
| Molecular Formula | C21H38N8O3S |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 2-[[1-amino-8-(3-aminopropylamino)octan-3-yl]sulfanylmethyl]-5-(6-aminopurin-9-yl)oxolane-3,4-diol |
| SMILES | NCCCNCCCCCC(CCN)SCC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C21H38N8O3S/c22-7-4-10-25-9-3-1-2-5-14(6-8-23)33-11-15-17(30)18(31)21(32-15)29-13-28-16-19(24)26-12-27-20(16)29/h12-15,17-18,21,25,30-31H,1-11,22-23H2,(H2,24,26,27) |
| InChIKey | IYEWZPHRHXRMCW-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 183.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|