C12H20O4 — CID 14566980
(2S,3S)-2,3-bis(methoxymethyl)-9-methyl-1,4-dioxaspiro[4.4]non-8-ene (PubChem CID 14566980) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (2S,3S)-2,3-bis(methoxymethyl)-9-methyl-1,4-dioxaspiro[4.4]non-8-ene.
| Compound Name | (2S,3S)-2,3-bis(methoxymethyl)-9-methyl-1,4-dioxaspiro[4.4]non-8-ene |
|---|---|
| PubChem CID | 14566980 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (2S,3S)-2,3-bis(methoxymethyl)-9-methyl-1,4-dioxaspiro[4.4]non-8-ene |
| SMILES | COC[C@@H]1OC2(CCC=C2C)O[C@H]1COC |
| InChI | InChI=1S/C12H20O4/c1-9-5-4-6-12(9)15-10(7-13-2)11(16-12)8-14-3/h5,10-11H,4,6-8H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | KDSPXQRDCZFNIS-QWRGUYRKSA-N |
| XLogP | 1.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|