C14H22O6 — CID 10039620
2-methyl-2-(3,3,6,6-tetramethoxycyclohexa-1,4-dien-1-yl)-1,3-dioxolane (PubChem CID 10039620) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is 2-methyl-2-(3,3,6,6-tetramethoxycyclohexa-1,4-dien-1-yl)-1,3-dioxolane.
| Compound Name | 2-methyl-2-(3,3,6,6-tetramethoxycyclohexa-1,4-dien-1-yl)-1,3-dioxolane |
|---|---|
| PubChem CID | 10039620 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-methyl-2-(3,3,6,6-tetramethoxycyclohexa-1,4-dien-1-yl)-1,3-dioxolane |
| SMILES | COC1(OC)C=CC(OC)(OC)C(C2(C)OCCO2)=C1 |
| InChI | InChI=1S/C14H22O6/c1-12(19-8-9-20-12)11-10-13(15-2,16-3)6-7-14(11,17-4)18-5/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | PPPCHKOIYNEHEO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|