methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate

C12H14O5 — CID 175475252

IUPACmethyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate
SMILESCOC(=O)C=Cc1ccc(C2(C)OCCO2)o1
InChIInChI=1S/C12H14O5/c1-12(15-7-8-16-12)10-5-3-9(17-10)4-6-11(13)14-2/h3-6H,7-8H2,1-2H3
InChIKeySJXDRQIMIYNETJ-UHFFFAOYSA-N
MW238.24 g/mol
LogP1.69
Rot. Bonds3

About methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate

methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate (PubChem CID 175475252) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate.

Molecular Properties

Compound Namemethyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate
PubChem CID175475252
Molecular FormulaC12H14O5
Molecular Weight238.24 g/mol
Exact Mass238.08
IUPAC Namemethyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate
SMILESCOC(=O)C=Cc1ccc(C2(C)OCCO2)o1
InChIInChI=1S/C12H14O5/c1-12(15-7-8-16-12)10-5-3-9(17-10)4-6-11(13)14-2/h3-6H,7-8H2,1-2H3
InChIKeySJXDRQIMIYNETJ-UHFFFAOYSA-N
XLogP1.69
TPSA57.90 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.24
LogP ≤ 51.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate?
The IUPAC name of methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate (CID 175475252) is methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate.
What is the SMILES notation for methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate?
The canonical SMILES for methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate is COC(=O)C=Cc1ccc(C2(C)OCCO2)o1.
What is the InChIKey of methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate?
The InChIKey is SJXDRQIMIYNETJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O5/c1-12(15-7-8-16-12)10-5-3-9(17-10)4-6-11(13)14-2/h3-6H,7-8H2,1-2H3.
What are the key properties of methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate?
methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate has a molecular weight of 238.24 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[5-(2-methyl-1,3-dioxolan-2-yl)furan-2-yl]prop-2-enoate is sourced from PubChem (CID 175475252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).