C44H64O16 — CID 101143097
5,5,11,11,17,17,23,23,25,25,26,26,27,27,28,28-hexadecamethoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,6,9,12,15,18,21-octaene (PubChem CID 101143097) has the molecular formula C44H64O16 and a molecular weight of 848.98 g/mol. Its IUPAC name is 5,5,11,11,17,17,23,23,25,25,26,26,27,27,28,28-hexadecamethoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,6,9,12,15,18,21-octaene.
| Compound Name | 5,5,11,11,17,17,23,23,25,25,26,26,27,27,28,28-hexadecamethoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,6,9,12,15,18,21-octaene |
|---|---|
| PubChem CID | 101143097 |
| Molecular Formula | C44H64O16 |
| Molecular Weight | 848.98 g/mol |
| Exact Mass | 848.42 |
| IUPAC Name | 5,5,11,11,17,17,23,23,25,25,26,26,27,27,28,28-hexadecamethoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,6,9,12,15,18,21-octaene |
| SMILES | COC1(OC)C=C2CC3=CC(OC)(OC)C=C(CC4=CC(OC)(OC)C=C(CC5=CC(OC)(OC)C=C(CC(=C1)C2(OC)OC)C5(OC)OC)C4(OC)OC)C3(OC)OC |
| InChI | InChI=1S/C44H64O16/c1-45-37(46-2)21-29-17-31-23-38(47-3,48-4)25-33(42(31,55-11)56-12)19-35-27-40(51-7,52-8)28-36(44(35,59-15)60-16)20-34-26-39(49-5,50-6)24-32(43(34,57-13)58-14)18-30(22-37)41(29,53-9)54-10/h21-28H,17-20H2,1-16H3 |
| InChIKey | RYRVMUJLCXOITI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 147.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.98 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|