C11H15NO3 — CID 14566918
6,6-dimethoxy-3,4-dihydro-2H-quinolin-4-ol (PubChem CID 14566918) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 6,6-dimethoxy-3,4-dihydro-2H-quinolin-4-ol.
| Compound Name | 6,6-dimethoxy-3,4-dihydro-2H-quinolin-4-ol |
|---|---|
| PubChem CID | 14566918 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 6,6-dimethoxy-3,4-dihydro-2H-quinolin-4-ol |
| SMILES | COC1(OC)C=CC2=NCCC(O)C2=C1 |
| InChI | InChI=1S/C11H15NO3/c1-14-11(15-2)5-3-9-8(7-11)10(13)4-6-12-9/h3,5,7,10,13H,4,6H2,1-2H3 |
| InChIKey | NCFFZEYDKJIJRB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|