C13H16O4 — CID 5314640
1,6-dihydroxy-6-methoxytricyclo[6.2.2.02,7]dodeca-2(7),4-dien-3-one (PubChem CID 5314640) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1,6-dihydroxy-6-methoxytricyclo[6.2.2.02,7]dodeca-2(7),4-dien-3-one.
| Compound Name | 1,6-dihydroxy-6-methoxytricyclo[6.2.2.02,7]dodeca-2(7),4-dien-3-one |
|---|---|
| PubChem CID | 5314640 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1,6-dihydroxy-6-methoxytricyclo[6.2.2.02,7]dodeca-2(7),4-dien-3-one |
| SMILES | COC1(O)C=CC(=O)C2=C1C1CCC2(O)CC1 |
| InChI | InChI=1S/C13H16O4/c1-17-13(16)7-4-9(14)11-10(13)8-2-5-12(11,15)6-3-8/h4,7-8,15-16H,2-3,5-6H2,1H3 |
| InChIKey | QGKPJKOLBGXBOD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|