C15H20O4 — CID 50993052
(1S,5S,8S)-10,10-dimethoxy-5-methyltricyclo[6.2.2.01,6]dodec-2-ene-4,9-dione (PubChem CID 50993052) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1S,5S,8S)-10,10-dimethoxy-5-methyltricyclo[6.2.2.01,6]dodec-2-ene-4,9-dione.
| Compound Name | (1S,5S,8S)-10,10-dimethoxy-5-methyltricyclo[6.2.2.01,6]dodec-2-ene-4,9-dione |
|---|---|
| PubChem CID | 50993052 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1S,5S,8S)-10,10-dimethoxy-5-methyltricyclo[6.2.2.01,6]dodec-2-ene-4,9-dione |
| SMILES | COC1(OC)C(=O)[C@H]2CC[C@@]13C=CC(=O)[C@@H](C)C3C2 |
| InChI | InChI=1S/C15H20O4/c1-9-11-8-10-4-6-14(11,7-5-12(9)16)15(18-2,19-3)13(10)17/h5,7,9-11H,4,6,8H2,1-3H3/t9-,10-,11?,14-/m0/s1 |
| InChIKey | LWKRNTDHCZBJQQ-IZUDUTOVSA-N |
| XLogP | 1.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|