C31H44O5 — CID 70204373
[(1S,3S,7S,8S,11S,12S,14S,16R)-15-[(4R)-5-methoxy-4-methyl-3-methylidene-2-oxopentyl]-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate (PubChem CID 70204373) has the molecular formula C31H44O5 and a molecular weight of 496.69 g/mol. Its IUPAC name is [(1S,3S,7S,8S,11S,12S,14S,16R)-15-[(4R)-5-methoxy-4-methyl-3-methylidene-2-oxopentyl]-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate.
| Compound Name | [(1S,3S,7S,8S,11S,12S,14S,16R)-15-[(4R)-5-methoxy-4-methyl-3-methylidene-2-oxopentyl]-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate |
|---|---|
| PubChem CID | 70204373 |
| Molecular Formula | C31H44O5 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | [(1S,3S,7S,8S,11S,12S,14S,16R)-15-[(4R)-5-methoxy-4-methyl-3-methylidene-2-oxopentyl]-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate |
| SMILES | C=C(C(=O)CC1[C@@H](OC(C)=O)C[C@@]2(C)[C@@H]3CC[C@H]4[C@H](C)C(=O)C=C[C@@]45C[C@@]35CC[C@]12C)[C@@H](C)COC |
| InChI | InChI=1S/C31H44O5/c1-18(16-35-7)19(2)25(34)14-23-26(36-21(4)32)15-29(6)27-9-8-22-20(3)24(33)10-11-30(22)17-31(27,30)13-12-28(23,29)5/h10-11,18,20,22-23,26-27H,2,8-9,12-17H2,1,3-7H3/t18-,20-,22-,23?,26-,27-,28+,29-,30+,31-/m0/s1 |
| InChIKey | CURJCGTYMGNBOE-BIPRISCSSA-N |
| XLogP | 5.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|