C35H50O6 — CID 123783800
[(1S,3S,7S,12S,14S,15R,16R)-15-[(2S,6R)-5,6-dimethyl-3,4-dioxo-7-prop-2-enoxyheptan-2-yl]-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate (PubChem CID 123783800) has the molecular formula C35H50O6 and a molecular weight of 566.78 g/mol. Its IUPAC name is [(1S,3S,7S,12S,14S,15R,16R)-15-[(2S,6R)-5,6-dimethyl-3,4-dioxo-7-prop-2-enoxyheptan-2-yl]-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate.
| Compound Name | [(1S,3S,7S,12S,14S,15R,16R)-15-[(2S,6R)-5,6-dimethyl-3,4-dioxo-7-prop-2-enoxyheptan-2-yl]-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate |
|---|---|
| PubChem CID | 123783800 |
| Molecular Formula | C35H50O6 |
| Molecular Weight | 566.78 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | [(1S,3S,7S,12S,14S,15R,16R)-15-[(2S,6R)-5,6-dimethyl-3,4-dioxo-7-prop-2-enoxyheptan-2-yl]-7,12,16-trimethyl-6-oxo-14-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl] acetate |
| SMILES | C=CCOC[C@H](C)C(C)C(=O)C(=O)[C@@H](C)[C@H]1[C@@H](OC(C)=O)C[C@@]2(C)C3CCC4[C@H](C)C(=O)C=C[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C35H50O6/c1-9-16-40-18-20(2)21(3)30(38)31(39)23(5)29-27(41-24(6)36)17-33(8)28-11-10-25-22(4)26(37)12-13-34(25)19-35(28,34)15-14-32(29,33)7/h9,12-13,20-23,25,27-29H,1,10-11,14-19H2,2-8H3/t20-,21?,22-,23-,25?,27-,28?,29-,32+,33-,34+,35-/m0/s1 |
| InChIKey | ZFBVHKRPTXEKHJ-GNIHGFFUSA-N |
| XLogP | 6.17 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.78 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|