C36H51NO8 — CID 76535518
[5-acetyloxy-6-(14-acetyloxy-7,12,16-trimethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl)-2-methyl-3-methylidene-4-oxoheptyl] 2-aminoacetate (PubChem CID 76535518) has the molecular formula C36H51NO8 and a molecular weight of 625.80 g/mol. Its IUPAC name is [5-acetyloxy-6-(14-acetyloxy-7,12,16-trimethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl)-2-methyl-3-methylidene-4-oxoheptyl] 2-aminoacetate.
| Compound Name | [5-acetyloxy-6-(14-acetyloxy-7,12,16-trimethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl)-2-methyl-3-methylidene-4-oxoheptyl] 2-aminoacetate |
|---|---|
| PubChem CID | 76535518 |
| Molecular Formula | C36H51NO8 |
| Molecular Weight | 625.80 g/mol |
| Exact Mass | 625.36 |
| IUPAC Name | [5-acetyloxy-6-(14-acetyloxy-7,12,16-trimethyl-6-oxo-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadec-4-enyl)-2-methyl-3-methylidene-4-oxoheptyl] 2-aminoacetate |
| SMILES | C=C(C(=O)C(OC(C)=O)C(C)C1C(OC(C)=O)CC2(C)C3CCC4C(C)C(=O)C=CC45CC35CCC12C)C(C)COC(=O)CN |
| InChI | InChI=1S/C36H51NO8/c1-19(17-43-29(41)16-37)20(2)31(42)32(45-24(6)39)22(4)30-27(44-23(5)38)15-34(8)28-10-9-25-21(3)26(40)11-12-35(25)18-36(28,35)14-13-33(30,34)7/h11-12,19,21-22,25,27-28,30,32H,2,9-10,13-18,37H2,1,3-8H3 |
| InChIKey | DVGYWPIKMQDPIH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.80 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|