C8H10O2 — CID 102121899
(1R,5S)-1-methoxybicyclo[3.2.0]hept-3-en-2-one (PubChem CID 102121899) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is (1R,5S)-1-methoxybicyclo[3.2.0]hept-3-en-2-one.
| Compound Name | (1R,5S)-1-methoxybicyclo[3.2.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 102121899 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (1R,5S)-1-methoxybicyclo[3.2.0]hept-3-en-2-one |
| SMILES | CO[C@]12CC[C@H]1C=CC2=O |
| InChI | InChI=1S/C8H10O2/c1-10-8-5-4-6(8)2-3-7(8)9/h2-3,6H,4-5H2,1H3/t6-,8-/m1/s1 |
| InChIKey | RCQICWIEDZORJU-HTRCEHHLSA-N |
| XLogP | 0.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |