C10H14O2 — CID 130126715
1,2,3,5,6,7-hexahydronaphthalene-1,5-diol (PubChem CID 130126715) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydronaphthalene-1,5-diol.
| Compound Name | 1,2,3,5,6,7-hexahydronaphthalene-1,5-diol |
|---|---|
| PubChem CID | 130126715 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 1,2,3,5,6,7-hexahydronaphthalene-1,5-diol |
| SMILES | OC1CCC=C2C1=CCCC2O |
| InChI | InChI=1S/C10H14O2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h3-4,9-12H,1-2,5-6H2 |
| InChIKey | CEDQJWULJYJFFK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |