About (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol
(1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol (PubChem CID 125036537) has the molecular formula C21H24O3
and a molecular weight of 324.42 g/mol. Its IUPAC name is (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol.
Molecular Properties
| Compound Name | (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol |
| PubChem CID | 125036537 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol |
| SMILES | O[C@@H]1CCC=C1c1cc(C2=CCC[C@H]2O)cc(C2=CCC[C@H]2O)c1 |
| InChI | InChI=1S/C21H24O3/c22-19-7-1-4-16(19)13-10-14(17-5-2-8-20(17)23)12-15(11-13)18-6-3-9-21(18)24/h4-6,10-12,19-24H,1-3,7-9H2/t19-,20-,21-/m1/s1 |
| InChIKey | WXSBWHZSNSZWLJ-NJDAHSKKSA-N |
| XLogP | 3.30 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol?
The IUPAC name of (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol (CID 125036537) is (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol.
What is the SMILES notation for (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol?
The canonical SMILES for (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol is O[C@@H]1CCC=C1c1cc(C2=CCC[C@H]2O)cc(C2=CCC[C@H]2O)c1.
What is the InChIKey of (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol?
The InChIKey is WXSBWHZSNSZWLJ-NJDAHSKKSA-N. The full InChI is InChI=1S/C21H24O3/c22-19-7-1-4-16(19)13-10-14(17-5-2-8-20(17)23)12-15(11-13)18-6-3-9-21(18)24/h4-6,10-12,19-24H,1-3,7-9H2/t19-,20-,21-/m1/s1.
What are the key properties of (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol?
(1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol has a molecular weight of 324.42 g/mol, XLogP of 3.30, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-[3,5-bis[(5R)-5-hydroxycyclopenten-1-yl]phenyl]cyclopent-2-en-1-ol is sourced from PubChem (CID 125036537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).