C7H11ClO — CID 58637363
(1S,6S)-2-chloro-6-methylcyclohex-2-en-1-ol (PubChem CID 58637363) has the molecular formula C7H11ClO and a molecular weight of 146.62 g/mol. Its IUPAC name is (1S,6S)-2-chloro-6-methylcyclohex-2-en-1-ol.
| Compound Name | (1S,6S)-2-chloro-6-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 58637363 |
| Molecular Formula | C7H11ClO |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | (1S,6S)-2-chloro-6-methylcyclohex-2-en-1-ol |
| SMILES | C[C@H]1CCC=C(Cl)[C@H]1O |
| InChI | InChI=1S/C7H11ClO/c1-5-3-2-4-6(8)7(5)9/h4-5,7,9H,2-3H2,1H3/t5-,7-/m0/s1 |
| InChIKey | RNIFOAXMZWTBAZ-FSPLSTOPSA-N |
| XLogP | 1.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |