C10H17Cl — CID 148572658
1-chloro-5,6-diethylcyclohexene (PubChem CID 148572658) has the molecular formula C10H17Cl and a molecular weight of 172.70 g/mol. Its IUPAC name is 1-chloro-5,6-diethylcyclohexene.
| Compound Name | 1-chloro-5,6-diethylcyclohexene |
|---|---|
| PubChem CID | 148572658 |
| Molecular Formula | C10H17Cl |
| Molecular Weight | 172.70 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 1-chloro-5,6-diethylcyclohexene |
| SMILES | CCC1CCC=C(Cl)C1CC |
| InChI | InChI=1S/C10H17Cl/c1-3-8-6-5-7-10(11)9(8)4-2/h7-9H,3-6H2,1-2H3 |
| InChIKey | MXEGUMICKGJOGD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.70 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |