C21H18F6O2 — CID 101198364
2-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(diphenyl)methyl]cyclopent-2-en-1-ol (PubChem CID 101198364) has the molecular formula C21H18F6O2 and a molecular weight of 416.36 g/mol. Its IUPAC name is 2-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(diphenyl)methyl]cyclopent-2-en-1-ol.
| Compound Name | 2-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(diphenyl)methyl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 101198364 |
| Molecular Formula | C21H18F6O2 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-[1,1,1,3,3,3-hexafluoropropan-2-yloxy(diphenyl)methyl]cyclopent-2-en-1-ol |
| SMILES | OC1CCC=C1C(OC(C(F)(F)F)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18F6O2/c22-20(23,24)18(21(25,26)27)29-19(14-8-3-1-4-9-14,15-10-5-2-6-11-15)16-12-7-13-17(16)28/h1-6,8-12,17-18,28H,7,13H2 |
| InChIKey | NHTFHKBJQCWKNT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|