C9H20O3Si — CID 10954683
trans-(1S,3S)-2-trimethylsilylcyclohexane-1,2,3-triol (PubChem CID 10954683) has the molecular formula C9H20O3Si and a molecular weight of 204.34 g/mol. Its IUPAC name is trans-(1S,3S)-2-trimethylsilylcyclohexane-1,2,3-triol.
| Compound Name | trans-(1S,3S)-2-trimethylsilylcyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 10954683 |
| Molecular Formula | C9H20O3Si |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | trans-(1S,3S)-2-trimethylsilylcyclohexane-1,2,3-triol |
| SMILES | C[Si](C)(C)C1(O)[C@@H](O)CCC[C@@H]1O |
| InChI | InChI=1S/C9H20O3Si/c1-13(2,3)9(12)7(10)5-4-6-8(9)11/h7-8,10-12H,4-6H2,1-3H3/t7-,8-/m0/s1 |
| InChIKey | NZUPNTUIYQGGIE-YUMQZZPRSA-N |
| XLogP | 0.50 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|