About trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol
trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol (PubChem CID 130874578) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol.
Molecular Properties
| Compound Name | trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol |
| PubChem CID | 130874578 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol |
| SMILES | CC(C)[C@@]1(O)CCC[C@@H]1O |
| InChI | InChI=1S/C8H16O2/c1-6(2)8(10)5-3-4-7(8)9/h6-7,9-10H,3-5H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | ACMXHUMXPMOAOT-YUMQZZPRSA-N |
| XLogP | 0.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol?
The IUPAC name of trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol (CID 130874578) is trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol.
What is the SMILES notation for trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol?
The canonical SMILES for trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol is CC(C)[C@@]1(O)CCC[C@@H]1O.
What is the InChIKey of trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol?
The InChIKey is ACMXHUMXPMOAOT-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H16O2/c1-6(2)8(10)5-3-4-7(8)9/h6-7,9-10H,3-5H2,1-2H3/t7-,8-/m0/s1.
What are the key properties of trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol?
trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol has a molecular weight of 144.21 g/mol, XLogP of 0.92, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-1-propan-2-ylcyclopentane-1,2-diol is sourced from PubChem (CID 130874578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).