5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid

C12H20O4 — CID 67743468

IUPAC5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid
SMILESCCC(CC=CC(=O)O)C1(O)CCCC1O
InChIInChI=1S/C12H20O4/c1-2-9(5-3-7-11(14)15)12(16)8-4-6-10(12)13/h3,7,9-10,13,16H,2,4-6,8H2,1H3,(H,14,15)
InChIKeyMHCVXZOEYYQSII-UHFFFAOYSA-N
MW228.29 g/mol
LogP1.32
Rot. Bonds5

About 5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid

5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid (PubChem CID 67743468) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid.

Molecular Properties

Compound Name5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid
PubChem CID67743468
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Name5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid
SMILESCCC(CC=CC(=O)O)C1(O)CCCC1O
InChIInChI=1S/C12H20O4/c1-2-9(5-3-7-11(14)15)12(16)8-4-6-10(12)13/h3,7,9-10,13,16H,2,4-6,8H2,1H3,(H,14,15)
InChIKeyMHCVXZOEYYQSII-UHFFFAOYSA-N
XLogP1.32
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 51.32
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid?
The IUPAC name of 5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid (CID 67743468) is 5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid.
What is the SMILES notation for 5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid?
The canonical SMILES for 5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid is CCC(CC=CC(=O)O)C1(O)CCCC1O.
What is the InChIKey of 5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid?
The InChIKey is MHCVXZOEYYQSII-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-2-9(5-3-7-11(14)15)12(16)8-4-6-10(12)13/h3,7,9-10,13,16H,2,4-6,8H2,1H3,(H,14,15).
What are the key properties of 5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid?
5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid has a molecular weight of 228.29 g/mol, XLogP of 1.32, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-dihydroxycyclopentyl)hept-2-enoic acid is sourced from PubChem (CID 67743468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).