About 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid
1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid (PubChem CID 70278404) has the molecular formula C15H25NO4
and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid.
Molecular Properties
| Compound Name | 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid |
| PubChem CID | 70278404 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid |
| SMILES | CCC(C)C12CCCC(CC1)N2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C11H21N.C4H4O4/c1-3-9(2)11-7-4-5-10(12-11)6-8-11;5-3(6)1-2-4(7)8/h9-10,12H,3-8H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | YMQLRROYXVXJTE-BTJKTKAUSA-N |
| XLogP | 2.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid?
The IUPAC name of 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid (CID 70278404) is 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid.
What is the SMILES notation for 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid?
The canonical SMILES for 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid is CCC(C)C12CCCC(CC1)N2.O=C(O)/C=C\C(=O)O.
What is the InChIKey of 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid?
The InChIKey is YMQLRROYXVXJTE-BTJKTKAUSA-N. The full InChI is InChI=1S/C11H21N.C4H4O4/c1-3-9(2)11-7-4-5-10(12-11)6-8-11;5-3(6)1-2-4(7)8/h9-10,12H,3-8H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid?
1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid has a molecular weight of 283.37 g/mol, XLogP of 2.42, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-8-azabicyclo[3.2.1]octane;(Z)-but-2-enedioic acid is sourced from PubChem (CID 70278404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).