About 1,2-di(propan-2-yl)cyclohexane-1,4-diol
1,2-di(propan-2-yl)cyclohexane-1,4-diol (PubChem CID 174428698) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)cyclohexane-1,4-diol.
Molecular Properties
| Compound Name | 1,2-di(propan-2-yl)cyclohexane-1,4-diol |
| PubChem CID | 174428698 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 1,2-di(propan-2-yl)cyclohexane-1,4-diol |
| SMILES | CC(C)C1CC(O)CCC1(O)C(C)C |
| InChI | InChI=1S/C12H24O2/c1-8(2)11-7-10(13)5-6-12(11,14)9(3)4/h8-11,13-14H,5-7H2,1-4H3 |
| InChIKey | WSTKMUZGRCCIMD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-di(propan-2-yl)cyclohexane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-di(propan-2-yl)cyclohexane-1,4-diol?
The IUPAC name of 1,2-di(propan-2-yl)cyclohexane-1,4-diol (CID 174428698) is 1,2-di(propan-2-yl)cyclohexane-1,4-diol.
What is the SMILES notation for 1,2-di(propan-2-yl)cyclohexane-1,4-diol?
The canonical SMILES for 1,2-di(propan-2-yl)cyclohexane-1,4-diol is CC(C)C1CC(O)CCC1(O)C(C)C.
What is the InChIKey of 1,2-di(propan-2-yl)cyclohexane-1,4-diol?
The InChIKey is WSTKMUZGRCCIMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-8(2)11-7-10(13)5-6-12(11,14)9(3)4/h8-11,13-14H,5-7H2,1-4H3.
What are the key properties of 1,2-di(propan-2-yl)cyclohexane-1,4-diol?
1,2-di(propan-2-yl)cyclohexane-1,4-diol has a molecular weight of 200.32 g/mol, XLogP of 2.19, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-di(propan-2-yl)cyclohexane-1,4-diol is sourced from PubChem (CID 174428698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).