C26H42O5 — CID 163108977
(2R,4S,5S,7R,8S,9R,13R,16R,19R,20R)-5,16,19,20-tetrahydroxy-7,9,13-trimethyl-5-propan-2-ylpentacyclo[10.8.0.02,9.04,8.013,18]icosan-3-one (PubChem CID 163108977) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is (2R,4S,5S,7R,8S,9R,13R,16R,19R,20R)-5,16,19,20-tetrahydroxy-7,9,13-trimethyl-5-propan-2-ylpentacyclo[10.8.0.02,9.04,8.013,18]icosan-3-one.
| Compound Name | (2R,4S,5S,7R,8S,9R,13R,16R,19R,20R)-5,16,19,20-tetrahydroxy-7,9,13-trimethyl-5-propan-2-ylpentacyclo[10.8.0.02,9.04,8.013,18]icosan-3-one |
|---|---|
| PubChem CID | 163108977 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | (2R,4S,5S,7R,8S,9R,13R,16R,19R,20R)-5,16,19,20-tetrahydroxy-7,9,13-trimethyl-5-propan-2-ylpentacyclo[10.8.0.02,9.04,8.013,18]icosan-3-one |
| SMILES | CC(C)[C@@]1(O)C[C@@H](C)[C@H]2[C@@H]1C(=O)[C@@H]1C3C(O)[C@H](O)C4C[C@H](O)CC[C@]4(C)C3CC[C@]21C |
| InChI | InChI=1S/C26H42O5/c1-12(2)26(31)11-13(3)18-20(26)23(30)19-17-15(7-9-25(18,19)5)24(4)8-6-14(27)10-16(24)21(28)22(17)29/h12-22,27-29,31H,6-11H2,1-5H3/t13-,14-,15?,16?,17?,18+,19+,20-,21-,22?,24-,25-,26+/m1/s1 |
| InChIKey | GJUBYLVVMLVGFI-OLQHRSAZSA-N |
| XLogP | 2.78 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |