C12H20O3 — CID 139053854
(1R,2R,6S,7R,11R)-6-methoxytricyclo[5.4.0.02,6]undecane-1,11-diol (PubChem CID 139053854) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (1R,2R,6S,7R,11R)-6-methoxytricyclo[5.4.0.02,6]undecane-1,11-diol.
| Compound Name | (1R,2R,6S,7R,11R)-6-methoxytricyclo[5.4.0.02,6]undecane-1,11-diol |
|---|---|
| PubChem CID | 139053854 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (1R,2R,6S,7R,11R)-6-methoxytricyclo[5.4.0.02,6]undecane-1,11-diol |
| SMILES | CO[C@@]12CCC[C@@H]1[C@@]1(O)[C@H](O)CCC[C@@H]21 |
| InChI | InChI=1S/C12H20O3/c1-15-11-7-3-5-9(11)12(14)8(11)4-2-6-10(12)13/h8-10,13-14H,2-7H2,1H3/t8-,9-,10+,11+,12+/m0/s1 |
| InChIKey | DPJWGFBWPKTDEH-PREPNJAASA-N |
| XLogP | 1.08 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |