C13H12F4O2 — CID 23273284
(1S,8R,9S)-3,4,5,6-tetrafluoro-8-methoxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-9-ol (PubChem CID 23273284) has the molecular formula C13H12F4O2 and a molecular weight of 276.23 g/mol. Its IUPAC name is (1S,8R,9S)-3,4,5,6-tetrafluoro-8-methoxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-9-ol.
| Compound Name | (1S,8R,9S)-3,4,5,6-tetrafluoro-8-methoxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-9-ol |
|---|---|
| PubChem CID | 23273284 |
| Molecular Formula | C13H12F4O2 |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (1S,8R,9S)-3,4,5,6-tetrafluoro-8-methoxytricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-9-ol |
| SMILES | CO[C@@]12CC[C@@H](C[C@@H]1O)c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C13H12F4O2/c1-19-13-3-2-5(4-6(13)18)7-8(13)10(15)12(17)11(16)9(7)14/h5-6,18H,2-4H2,1H3/t5-,6-,13-/m0/s1 |
| InChIKey | PJHVSISQVHWYPJ-BIOYQXMXSA-N |
| XLogP | 2.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|