C14H8F6O4 — CID 14568419
ethyl 1-oxo-6,7-bis(trifluoromethyl)isochromene-3-carboxylate (PubChem CID 14568419) has the molecular formula C14H8F6O4 and a molecular weight of 354.20 g/mol. Its IUPAC name is ethyl 1-oxo-6,7-bis(trifluoromethyl)isochromene-3-carboxylate.
| Compound Name | ethyl 1-oxo-6,7-bis(trifluoromethyl)isochromene-3-carboxylate |
|---|---|
| PubChem CID | 14568419 |
| Molecular Formula | C14H8F6O4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | ethyl 1-oxo-6,7-bis(trifluoromethyl)isochromene-3-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(C(F)(F)F)c(C(F)(F)F)cc2c(=O)o1 |
| InChI | InChI=1S/C14H8F6O4/c1-2-23-12(22)10-4-6-3-8(13(15,16)17)9(14(18,19)20)5-7(6)11(21)24-10/h3-5H,2H2,1H3 |
| InChIKey | CJMPNFUFWCUINL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |