C7H6F3NO3 — CID 158434340
ethyl 2-(trifluoromethyl)-1,3-oxazole-5-carboxylate (PubChem CID 158434340) has the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. Its IUPAC name is ethyl 2-(trifluoromethyl)-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 2-(trifluoromethyl)-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 158434340 |
| Molecular Formula | C7H6F3NO3 |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | ethyl 2-(trifluoromethyl)-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C(F)(F)F)o1 |
| InChI | InChI=1S/C7H6F3NO3/c1-2-13-5(12)4-3-11-6(14-4)7(8,9)10/h3H,2H2,1H3 |
| InChIKey | HCASIADCRLJOQT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |