About ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate
ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate (PubChem CID 156769459) has the molecular formula C7H6F3NO3S
and a molecular weight of 241.19 g/mol. Its IUPAC name is ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate.
Analyze ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate?
The IUPAC name of ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate (CID 156769459) is ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate?
The canonical SMILES for ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate is CCOC(=O)c1cnc(SC(F)(F)F)o1.
What is the InChIKey of ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate?
The InChIKey is GKGURYHYFZEBGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3NO3S/c1-2-13-5(12)4-3-11-6(14-4)15-7(8,9)10/h3H,2H2,1H3.
What are the key properties of ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate?
ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate has a molecular weight of 241.19 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(trifluoromethylsulfanyl)-1,3-oxazole-5-carboxylate is sourced from PubChem (CID 156769459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).