About 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine
5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine (PubChem CID 14570320) has the molecular formula C19H22N6O
and a molecular weight of 350.43 g/mol. Its IUPAC name is 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine |
| PubChem CID | 14570320 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cc(N2CCOCC2)nc2cc(Cc3cnc(N)nc3N)ccc12 |
| InChI | InChI=1S/C19H22N6O/c1-12-8-17(25-4-6-26-7-5-25)23-16-10-13(2-3-15(12)16)9-14-11-22-19(21)24-18(14)20/h2-3,8,10-11H,4-7,9H2,1H3,(H4,20,21,22,24) |
| InChIKey | WQNAKTXBBGBITL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine?
The IUPAC name of 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine (CID 14570320) is 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine.
What is the SMILES notation for 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine?
The canonical SMILES for 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine is Cc1cc(N2CCOCC2)nc2cc(Cc3cnc(N)nc3N)ccc12.
What is the InChIKey of 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine?
The InChIKey is WQNAKTXBBGBITL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N6O/c1-12-8-17(25-4-6-26-7-5-25)23-16-10-13(2-3-15(12)16)9-14-11-22-19(21)24-18(14)20/h2-3,8,10-11H,4-7,9H2,1H3,(H4,20,21,22,24).
What are the key properties of 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine?
5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine has a molecular weight of 350.43 g/mol, XLogP of 1.93, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-methyl-2-morpholin-4-ylquinolin-7-yl)methyl]pyrimidine-2,4-diamine is sourced from PubChem (CID 14570320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).