C16H21N3O5S — CID 14575286
N-[(3S,4R)-3-methoxypiperidin-4-yl]-N-methyl-1,3-benzothiazol-2-amine;oxalic acid (PubChem CID 14575286) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is N-[(3S,4R)-3-methoxypiperidin-4-yl]-N-methyl-1,3-benzothiazol-2-amine;oxalic acid.
| Compound Name | N-[(3S,4R)-3-methoxypiperidin-4-yl]-N-methyl-1,3-benzothiazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 14575286 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[(3S,4R)-3-methoxypiperidin-4-yl]-N-methyl-1,3-benzothiazol-2-amine;oxalic acid |
| SMILES | CO[C@H]1CNCC[C@H]1N(C)c1nc2ccccc2s1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H19N3OS.C2H2O4/c1-17(11-7-8-15-9-12(11)18-2)14-16-10-5-3-4-6-13(10)19-14;3-1(4)2(5)6/h3-6,11-12,15H,7-9H2,1-2H3;(H,3,4)(H,5,6)/t11-,12+;/m1./s1 |
| InChIKey | QMJRTYYSLDVTLM-LYCTWNKOSA-N |
| XLogP | 1.26 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|