C23H25N3O2S — CID 14580032
3-[3-(4-phenylpiperazin-1-yl)propyl]-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide (PubChem CID 14580032) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 3-[3-(4-phenylpiperazin-1-yl)propyl]-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide.
| Compound Name | 3-[3-(4-phenylpiperazin-1-yl)propyl]-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 14580032 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 3-[3-(4-phenylpiperazin-1-yl)propyl]-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
| SMILES | O=S1(=O)c2cccc3cccc(c23)N1CCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H25N3O2S/c27-29(28)22-12-5-8-19-7-4-11-21(23(19)22)26(29)14-6-13-24-15-17-25(18-16-24)20-9-2-1-3-10-20/h1-5,7-12H,6,13-18H2 |
| InChIKey | AWSBXOYZYNLCBZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |