C27H26N4O5 — CID 14581970
[(2R,3S,5R)-5-(4-aminobenzotriazol-2-yl)-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 14581970) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-aminobenzotriazol-2-yl)-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S,5R)-5-(4-aminobenzotriazol-2-yl)-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 14581970 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [(2R,3S,5R)-5-(4-aminobenzotriazol-2-yl)-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2O[C@@H](n3nc4cccc(N)c4n3)C[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H26N4O5/c1-16-6-10-18(11-7-16)26(32)34-15-23-22(36-27(33)19-12-8-17(2)9-13-19)14-24(35-23)31-29-21-5-3-4-20(28)25(21)30-31/h3-13,22-24H,14-15,28H2,1-2H3/t22-,23+,24+/m0/s1 |
| InChIKey | YYUMMSLRCOLKQE-RBZQAINGSA-N |
| XLogP | 4.00 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|