C23H36O3 — CID 14584694
(3aS,5aR,6R,8aR)-6-[(E,2R,5R)-5-ethyl-6-methylhept-3-en-2-yl]-3a-methoxy-5a-methyl-4,5,6,7,8,8a-hexahydrocyclopenta[e][1]benzofuran-2-one (PubChem CID 14584694) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (3aS,5aR,6R,8aR)-6-[(E,2R,5R)-5-ethyl-6-methylhept-3-en-2-yl]-3a-methoxy-5a-methyl-4,5,6,7,8,8a-hexahydrocyclopenta[e][1]benzofuran-2-one.
| Compound Name | (3aS,5aR,6R,8aR)-6-[(E,2R,5R)-5-ethyl-6-methylhept-3-en-2-yl]-3a-methoxy-5a-methyl-4,5,6,7,8,8a-hexahydrocyclopenta[e][1]benzofuran-2-one |
|---|---|
| PubChem CID | 14584694 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (3aS,5aR,6R,8aR)-6-[(E,2R,5R)-5-ethyl-6-methylhept-3-en-2-yl]-3a-methoxy-5a-methyl-4,5,6,7,8,8a-hexahydrocyclopenta[e][1]benzofuran-2-one |
| SMILES | CC[C@@H](/C=C/[C@@H](C)[C@H]1CC[C@H]2C3=CC(=O)O[C@@]3(OC)CC[C@]12C)C(C)C |
| InChI | InChI=1S/C23H36O3/c1-7-17(15(2)3)9-8-16(4)18-10-11-19-20-14-21(24)26-23(20,25-6)13-12-22(18,19)5/h8-9,14-19H,7,10-13H2,1-6H3/b9-8+/t16-,17+,18-,19+,22-,23+/m1/s1 |
| InChIKey | NXGGSWGPPXFCIU-FZHBMWNWSA-N |
| XLogP | 5.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|