C29H42O2 — CID 23425005
(10R,13R,17R)-17-[(E,2R)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,9,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione (PubChem CID 23425005) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is (10R,13R,17R)-17-[(E,2R)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,9,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione.
| Compound Name | (10R,13R,17R)-17-[(E,2R)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,9,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
|---|---|
| PubChem CID | 23425005 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | (10R,13R,17R)-17-[(E,2R)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,9,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
| SMILES | CCC(/C=C/[C@@H](C)[C@H]1CCC2C3=CC(=O)C4=CC(=O)CC[C@]4(C)C3CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C29H42O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-22-17-27(31)26-16-21(30)12-14-29(26,6)25(22)13-15-28(23,24)5/h8-9,16-20,23-25H,7,10-15H2,1-6H3/b9-8+/t19-,20?,23-,24?,25?,28-,29-/m1/s1 |
| InChIKey | KPQRMNLCIZLEFE-VFXFFUQPSA-N |
| XLogP | 7.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|