C28H40O — CID 163115584
17-(5,6-dimethylhepta-3,6-dien-2-yl)-10,13-dimethyl-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 163115584) has the molecular formula C28H40O and a molecular weight of 392.63 g/mol. Its IUPAC name is 17-(5,6-dimethylhepta-3,6-dien-2-yl)-10,13-dimethyl-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-(5,6-dimethylhepta-3,6-dien-2-yl)-10,13-dimethyl-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 163115584 |
| Molecular Formula | C28H40O |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | 17-(5,6-dimethylhepta-3,6-dien-2-yl)-10,13-dimethyl-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C(C)C(C)C=CC(C)C1CCC2C3=CCC4=CC(=O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C28H40O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-8,10,17,19-20,24-26H,1,9,11-16H2,2-6H3 |
| InChIKey | XYJDJPIPXFRIGW-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|