C27H40O3 — CID 24900484
(2S)-6-[(10R,13R,17R)-10,13-dimethyl-3-oxo-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid (PubChem CID 24900484) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is (2S)-6-[(10R,13R,17R)-10,13-dimethyl-3-oxo-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid.
| Compound Name | (2S)-6-[(10R,13R,17R)-10,13-dimethyl-3-oxo-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 24900484 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | (2S)-6-[(10R,13R,17R)-10,13-dimethyl-3-oxo-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptanoic acid |
| SMILES | CC(CCC[C@H](C)C(=O)O)[C@H]1CCC2C3=CCC4=CC(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H40O3/c1-17(6-5-7-18(2)25(29)30)22-10-11-23-21-9-8-19-16-20(28)12-14-26(19,3)24(21)13-15-27(22,23)4/h9,16-18,22-24H,5-8,10-15H2,1-4H3,(H,29,30)/t17?,18-,22+,23?,24?,26-,27+/m0/s1 |
| InChIKey | OSVJQLDSKUEUCV-JAUFIBQBSA-N |
| XLogP | 6.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|