C27H40O — CID 143505004
(14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 143505004) has the molecular formula C27H40O and a molecular weight of 380.62 g/mol. Its IUPAC name is (14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 143505004 |
| Molecular Formula | C27H40O |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | (14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC[C@H]2C3=CCC4=CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H40O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,10,17,19,23-25H,6,8-9,11-16H2,1-5H3/t19-,23-,24+,25?,26?,27?/m1/s1 |
| InChIKey | CEAHOBSZGYSEOA-VSUYDEGGSA-N |
| XLogP | 7.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|