C27H42O2 — CID 71166303
(10R,13R,17R)-17-[(6R)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 71166303) has the molecular formula C27H42O2 and a molecular weight of 398.63 g/mol. Its IUPAC name is (10R,13R,17R)-17-[(6R)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13R,17R)-17-[(6R)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 71166303 |
| Molecular Formula | C27H42O2 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.32 |
| IUPAC Name | (10R,13R,17R)-17-[(6R)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-1,2,6,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(CCC[C@@H](C)CO)[C@H]1CCC2C3=CCC4=CC(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H42O2/c1-18(17-28)6-5-7-19(2)23-10-11-24-22-9-8-20-16-21(29)12-14-26(20,3)25(22)13-15-27(23,24)4/h9,16,18-19,23-25,28H,5-8,10-15,17H2,1-4H3/t18-,19?,23-,24?,25?,26+,27-/m1/s1 |
| InChIKey | HSOJSPIBMLQBIY-MZOZXHSRSA-N |
| XLogP | 6.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|