C11H14O2 — CID 14589234
6,8-dimethyl-1-oxaspiro[4.5]deca-3,7-dien-2-one (PubChem CID 14589234) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 6,8-dimethyl-1-oxaspiro[4.5]deca-3,7-dien-2-one.
| Compound Name | 6,8-dimethyl-1-oxaspiro[4.5]deca-3,7-dien-2-one |
|---|---|
| PubChem CID | 14589234 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 6,8-dimethyl-1-oxaspiro[4.5]deca-3,7-dien-2-one |
| SMILES | CC1=CC(C)C2(C=CC(=O)O2)CC1 |
| InChI | InChI=1S/C11H14O2/c1-8-3-5-11(9(2)7-8)6-4-10(12)13-11/h4,6-7,9H,3,5H2,1-2H3 |
| InChIKey | KGWAWRXTGCXUJR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|