C20H19ClN2O3 — CID 1459093
N-[(2-chlorophenyl)methyl]-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]acetamide (PubChem CID 1459093) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 1459093 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]acetamide |
| SMILES | COc1ccc2[nH]c(=O)c(CN(Cc3ccccc3Cl)C(C)=O)cc2c1 |
| InChI | InChI=1S/C20H19ClN2O3/c1-13(24)23(11-14-5-3-4-6-18(14)21)12-16-9-15-10-17(26-2)7-8-19(15)22-20(16)25/h3-10H,11-12H2,1-2H3,(H,22,25) |
| InChIKey | GQDBELUAECHQHY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |