About [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide
[1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide (PubChem CID 14592500) has the molecular formula C24H32INO4
and a molecular weight of 525.43 g/mol. Its IUPAC name is [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide.
Molecular Properties
| Compound Name | [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide |
| PubChem CID | 14592500 |
| Molecular Formula | C24H32INO4 |
| Molecular Weight | 525.43 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide |
| SMILES | C[N+]1(CC(COCc2ccccc2)OC(=O)CCc2ccccc2)CCOCC1.[I-] |
| InChI | InChI=1S/C24H32NO4.HI/c1-25(14-16-27-17-15-25)18-23(20-28-19-22-10-6-3-7-11-22)29-24(26)13-12-21-8-4-2-5-9-21;/h2-11,23H,12-20H2,1H3;1H/q+1;/p-1 |
| InChIKey | UTUATCBQDYAVBR-UHFFFAOYSA-M |
| XLogP | 0.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 525.43 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide?
The IUPAC name of [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide (CID 14592500) is [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide.
What is the SMILES notation for [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide?
The canonical SMILES for [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide is C[N+]1(CC(COCc2ccccc2)OC(=O)CCc2ccccc2)CCOCC1.[I-].
What is the InChIKey of [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide?
The InChIKey is UTUATCBQDYAVBR-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H32NO4.HI/c1-25(14-16-27-17-15-25)18-23(20-28-19-22-10-6-3-7-11-22)29-24(26)13-12-21-8-4-2-5-9-21;/h2-11,23H,12-20H2,1H3;1H/q+1;/p-1.
What are the key properties of [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide?
[1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide has a molecular weight of 525.43 g/mol, XLogP of 0.23, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-methylmorpholin-4-ium-4-yl)-3-phenylmethoxypropan-2-yl] 3-phenylpropanoate iodide is sourced from PubChem (CID 14592500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).