C20H26N2O3 — CID 14595085
4-[(Z)-1-(cyclohexen-1-yl)-4-nitro-3-phenylbut-1-enyl]morpholine (PubChem CID 14595085) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-[(Z)-1-(cyclohexen-1-yl)-4-nitro-3-phenylbut-1-enyl]morpholine.
| Compound Name | 4-[(Z)-1-(cyclohexen-1-yl)-4-nitro-3-phenylbut-1-enyl]morpholine |
|---|---|
| PubChem CID | 14595085 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 4-[(Z)-1-(cyclohexen-1-yl)-4-nitro-3-phenylbut-1-enyl]morpholine |
| SMILES | O=[N+]([O-])CC(/C=C(/C1=CCCCC1)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O3/c23-22(24)16-19(17-7-3-1-4-8-17)15-20(18-9-5-2-6-10-18)21-11-13-25-14-12-21/h1,3-4,7-9,15,19H,2,5-6,10-14,16H2/b20-15- |
| InChIKey | QOORKPGMNDRRIR-HKWRFOASSA-N |
| XLogP | 3.76 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|