About N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide
N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide (PubChem CID 1459629) has the molecular formula C21H21N5O
and a molecular weight of 359.43 g/mol. Its IUPAC name is N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide |
| PubChem CID | 1459629 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide |
| SMILES | CC(=O)N(Cc1ccccc1)Cc1cc2cc(C)c(C)cc2n2nnnc12 |
| InChI | InChI=1S/C21H21N5O/c1-14-9-18-11-19(21-22-23-24-26(21)20(18)10-15(14)2)13-25(16(3)27)12-17-7-5-4-6-8-17/h4-11H,12-13H2,1-3H3 |
| InChIKey | KZYQNULBSPXXQG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide?
The IUPAC name of N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide (CID 1459629) is N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide.
What is the SMILES notation for N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide?
The canonical SMILES for N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide is CC(=O)N(Cc1ccccc1)Cc1cc2cc(C)c(C)cc2n2nnnc12.
What is the InChIKey of N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide?
The InChIKey is KZYQNULBSPXXQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N5O/c1-14-9-18-11-19(21-22-23-24-26(21)20(18)10-15(14)2)13-25(16(3)27)12-17-7-5-4-6-8-17/h4-11H,12-13H2,1-3H3.
What are the key properties of N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide?
N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide has a molecular weight of 359.43 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[(7,8-dimethyltetrazolo[1,5-a]quinolin-4-yl)methyl]acetamide is sourced from PubChem (CID 1459629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).