C25H21N5O — CID 1466370
N-benzyl-N-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]benzamide (PubChem CID 1466370) has the molecular formula C25H21N5O and a molecular weight of 407.48 g/mol. Its IUPAC name is N-benzyl-N-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]benzamide.
| Compound Name | N-benzyl-N-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 1466370 |
| Molecular Formula | C25H21N5O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-benzyl-N-[(7-methyltetrazolo[1,5-a]quinolin-4-yl)methyl]benzamide |
| SMILES | Cc1ccc2c(c1)cc(CN(Cc1ccccc1)C(=O)c1ccccc1)c1nnnn12 |
| InChI | InChI=1S/C25H21N5O/c1-18-12-13-23-21(14-18)15-22(24-26-27-28-30(23)24)17-29(16-19-8-4-2-5-9-19)25(31)20-10-6-3-7-11-20/h2-15H,16-17H2,1H3 |
| InChIKey | UDLKSWCJAUOFDS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |