C20H43N3OS — CID 14597110
N-[2-(2-aminoethylamino)ethyl]-3-dodecylsulfanyl-2-methylpropanamide (PubChem CID 14597110) has the molecular formula C20H43N3OS and a molecular weight of 373.65 g/mol. Its IUPAC name is N-[2-(2-aminoethylamino)ethyl]-3-dodecylsulfanyl-2-methylpropanamide.
| Compound Name | N-[2-(2-aminoethylamino)ethyl]-3-dodecylsulfanyl-2-methylpropanamide |
|---|---|
| PubChem CID | 14597110 |
| Molecular Formula | C20H43N3OS |
| Molecular Weight | 373.65 g/mol |
| Exact Mass | 373.31 |
| IUPAC Name | N-[2-(2-aminoethylamino)ethyl]-3-dodecylsulfanyl-2-methylpropanamide |
| SMILES | CCCCCCCCCCCCSCC(C)C(=O)NCCNCCN |
| InChI | InChI=1S/C20H43N3OS/c1-3-4-5-6-7-8-9-10-11-12-17-25-18-19(2)20(24)23-16-15-22-14-13-21/h19,22H,3-18,21H2,1-2H3,(H,23,24) |
| InChIKey | TUGMAMKNPZRQQK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.65 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|