C25H21ClFN3O — CID 1459888
N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-2-fluoro-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 1459888) has the molecular formula C25H21ClFN3O and a molecular weight of 433.91 g/mol. Its IUPAC name is N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-2-fluoro-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-2-fluoro-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 1459888 |
| Molecular Formula | C25H21ClFN3O |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-2-fluoro-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | Cc1cc(C)c2cc(CN(Cc3cccnc3)C(=O)c3ccccc3F)c(Cl)nc2c1 |
| InChI | InChI=1S/C25H21ClFN3O/c1-16-10-17(2)21-12-19(24(26)29-23(21)11-16)15-30(14-18-6-5-9-28-13-18)25(31)20-7-3-4-8-22(20)27/h3-13H,14-15H2,1-2H3 |
| InChIKey | CJVKEWZZRODLNU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|