C18H18Br3NO3 — CID 14599975
[2-(3,4,5-tribromo-1H-pyrrole-2-carbonyl)phenyl] heptanoate (PubChem CID 14599975) has the molecular formula C18H18Br3NO3 and a molecular weight of 536.06 g/mol. Its IUPAC name is [2-(3,4,5-tribromo-1H-pyrrole-2-carbonyl)phenyl] heptanoate.
| Compound Name | [2-(3,4,5-tribromo-1H-pyrrole-2-carbonyl)phenyl] heptanoate |
|---|---|
| PubChem CID | 14599975 |
| Molecular Formula | C18H18Br3NO3 |
| Molecular Weight | 536.06 g/mol |
| Exact Mass | 532.88 |
| IUPAC Name | [2-(3,4,5-tribromo-1H-pyrrole-2-carbonyl)phenyl] heptanoate |
| SMILES | CCCCCCC(=O)Oc1ccccc1C(=O)c1[nH]c(Br)c(Br)c1Br |
| InChI | InChI=1S/C18H18Br3NO3/c1-2-3-4-5-10-13(23)25-12-9-7-6-8-11(12)17(24)16-14(19)15(20)18(21)22-16/h6-9,22H,2-5,10H2,1H3 |
| InChIKey | UFWQFGAIBPKRIF-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.06 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|